Kalciumnitrat

Från Wikipedia
Hoppa till: navigering, sök
Kalciumnitrat
Calcium nitrate.png
Systematiskt namn Kalciumnitrat
Övriga namn Kalksalpeter, Norgessalpeter
Kemisk formel Ca(NO3)2
Molmassa 164,088 g/mol
Utseende Färglösa kristaller
CAS-nummer 10124-37-5
SMILES [Ca+2].[O-][N+](=O)[O-].[O-][N+](=O)[O-]
Egenskaper
Densitet 2,504 g/cm³
Löslighet (vatten) 1290 g/l (20 °C)
Smältpunkt 561 °C
Faror
Huvudfara
Irriterande Irriterande
NFPA 704

NFPA 704.svg

0
1
3
OX
SI-enheter & STP används om ej annat angivits

Kalciumnitrat, kalksalpeter eller norgessalpeter, Ca(NO3)2, är ett salt som består av kalciumjoner och nitratjoner.

Kalciumnitrat är framför allt viktigt som gödningsmedel. Det framställs genom att behandla kalciumkarbonat med salpetersyra enligt formeln

\rm CaCO_3 + 2\ HNO_3 \rightarrow Ca(NO_3)_2 + CO_2 + H_2O